C11H13N3O4S2 — CID 102692588
N-(4-ethylsulfonylphenyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102692588) has the molecular formula C11H13N3O4S2 and a molecular weight of 315.38 g/mol. Its IUPAC name is N-(4-ethylsulfonylphenyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(4-ethylsulfonylphenyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102692588 |
| Molecular Formula | C11H13N3O4S2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | N-(4-ethylsulfonylphenyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCS(=O)(=O)c1ccc(NS(=O)(=O)c2ccn[nH]2)cc1 |
| InChI | InChI=1S/C11H13N3O4S2/c1-2-19(15,16)10-5-3-9(4-6-10)14-20(17,18)11-7-8-12-13-11/h3-8,14H,2H2,1H3,(H,12,13) |
| InChIKey | QUIVAXNJIIFJKM-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |