C9H11N5O4S2 — CID 102692751
N-[3-(sulfamoylamino)phenyl]-1H-pyrazole-5-sulfonamide (PubChem CID 102692751) has the molecular formula C9H11N5O4S2 and a molecular weight of 317.35 g/mol. Its IUPAC name is N-[3-(sulfamoylamino)phenyl]-1H-pyrazole-5-sulfonamide.
| Compound Name | N-[3-(sulfamoylamino)phenyl]-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102692751 |
| Molecular Formula | C9H11N5O4S2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | N-[3-(sulfamoylamino)phenyl]-1H-pyrazole-5-sulfonamide |
| SMILES | NS(=O)(=O)Nc1cccc(NS(=O)(=O)c2ccn[nH]2)c1 |
| InChI | InChI=1S/C9H11N5O4S2/c10-20(17,18)14-8-3-1-2-7(6-8)13-19(15,16)9-4-5-11-12-9/h1-6,13-14H,(H,11,12)(H2,10,17,18) |
| InChIKey | IDPDPQUBGQZAOI-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 147.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |