C10H9FN4O3S — CID 102692467
2-fluoro-5-(1H-pyrazol-5-ylsulfonylamino)benzamide (PubChem CID 102692467) has the molecular formula C10H9FN4O3S and a molecular weight of 284.27 g/mol. Its IUPAC name is 2-fluoro-5-(1H-pyrazol-5-ylsulfonylamino)benzamide.
| Compound Name | 2-fluoro-5-(1H-pyrazol-5-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 102692467 |
| Molecular Formula | C10H9FN4O3S |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 2-fluoro-5-(1H-pyrazol-5-ylsulfonylamino)benzamide |
| SMILES | NC(=O)c1cc(NS(=O)(=O)c2ccn[nH]2)ccc1F |
| InChI | InChI=1S/C10H9FN4O3S/c11-8-2-1-6(5-7(8)10(12)16)15-19(17,18)9-3-4-13-14-9/h1-5,15H,(H2,12,16)(H,13,14) |
| InChIKey | HKFZFDIAUGKJLG-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |