C10H8FN3O4S — CID 102690908
3-fluoro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid (PubChem CID 102690908) has the molecular formula C10H8FN3O4S and a molecular weight of 285.26 g/mol. Its IUPAC name is 3-fluoro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid.
| Compound Name | 3-fluoro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 102690908 |
| Molecular Formula | C10H8FN3O4S |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 3-fluoro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid |
| SMILES | O=C(O)c1cccc(F)c1NS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C10H8FN3O4S/c11-7-3-1-2-6(10(15)16)9(7)14-19(17,18)8-4-5-12-13-8/h1-5,14H,(H,12,13)(H,15,16) |
| InChIKey | MEOACIHBIYIGIQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |