C8H7N3O4S2 — CID 102690657
3-(1H-pyrazol-5-ylsulfonylamino)thiophene-2-carboxylic acid (PubChem CID 102690657) has the molecular formula C8H7N3O4S2 and a molecular weight of 273.30 g/mol. Its IUPAC name is 3-(1H-pyrazol-5-ylsulfonylamino)thiophene-2-carboxylic acid.
| Compound Name | 3-(1H-pyrazol-5-ylsulfonylamino)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 102690657 |
| Molecular Formula | C8H7N3O4S2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | 3-(1H-pyrazol-5-ylsulfonylamino)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1NS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C8H7N3O4S2/c12-8(13)7-5(2-4-16-7)11-17(14,15)6-1-3-9-10-6/h1-4,11H,(H,9,10)(H,12,13) |
| InChIKey | NGZKETAYZBHWQQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |