3,6-dichloro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid

C10H7Cl2N3O4S — CID 107049512

IUPAC3,6-dichloro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid
SMILESO=C(O)c1c(Cl)ccc(Cl)c1NS(=O)(=O)c1ccn[nH]1
InChIInChI=1S/C10H7Cl2N3O4S/c11-5-1-2-6(12)9(8(5)10(16)17)15-20(18,19)7-3-4-13-14-7/h1-4,15H,(H,13,14)(H,16,17)
InChIKeyIEUIVRAMZRPNRE-UHFFFAOYSA-N
MW336.16 g/mol
LogP2.22
Rot. Bonds4

About 3,6-dichloro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid

3,6-dichloro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid (PubChem CID 107049512) has the molecular formula C10H7Cl2N3O4S and a molecular weight of 336.16 g/mol. Its IUPAC name is 3,6-dichloro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid.

Molecular Properties

Compound Name3,6-dichloro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid
PubChem CID107049512
Molecular FormulaC10H7Cl2N3O4S
Molecular Weight336.16 g/mol
Exact Mass334.95
IUPAC Name3,6-dichloro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid
SMILESO=C(O)c1c(Cl)ccc(Cl)c1NS(=O)(=O)c1ccn[nH]1
InChIInChI=1S/C10H7Cl2N3O4S/c11-5-1-2-6(12)9(8(5)10(16)17)15-20(18,19)7-3-4-13-14-7/h1-4,15H,(H,13,14)(H,16,17)
InChIKeyIEUIVRAMZRPNRE-UHFFFAOYSA-N
XLogP2.22
TPSA112.15 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500336.16
LogP ≤ 52.22
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 3,6-dichloro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,6-dichloro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid?
The IUPAC name of 3,6-dichloro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid (CID 107049512) is 3,6-dichloro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid.
What is the SMILES notation for 3,6-dichloro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid?
The canonical SMILES for 3,6-dichloro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid is O=C(O)c1c(Cl)ccc(Cl)c1NS(=O)(=O)c1ccn[nH]1.
What is the InChIKey of 3,6-dichloro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid?
The InChIKey is IEUIVRAMZRPNRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl2N3O4S/c11-5-1-2-6(12)9(8(5)10(16)17)15-20(18,19)7-3-4-13-14-7/h1-4,15H,(H,13,14)(H,16,17).
What are the key properties of 3,6-dichloro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid?
3,6-dichloro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid has a molecular weight of 336.16 g/mol, XLogP of 2.22, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dichloro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid is sourced from PubChem (CID 107049512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).