C10H7Cl2N3O4S — CID 107049512
3,6-dichloro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid (PubChem CID 107049512) has the molecular formula C10H7Cl2N3O4S and a molecular weight of 336.16 g/mol. Its IUPAC name is 3,6-dichloro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid.
| Compound Name | 3,6-dichloro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 107049512 |
| Molecular Formula | C10H7Cl2N3O4S |
| Molecular Weight | 336.16 g/mol |
| Exact Mass | 334.95 |
| IUPAC Name | 3,6-dichloro-2-(1H-pyrazol-5-ylsulfonylamino)benzoic acid |
| SMILES | O=C(O)c1c(Cl)ccc(Cl)c1NS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C10H7Cl2N3O4S/c11-5-1-2-6(12)9(8(5)10(16)17)15-20(18,19)7-3-4-13-14-7/h1-4,15H,(H,13,14)(H,16,17) |
| InChIKey | IEUIVRAMZRPNRE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.16 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |