C9H9N3O4S2 — CID 43443076
3-[(1-methylpyrazol-4-yl)sulfonylamino]thiophene-2-carboxylic acid (PubChem CID 43443076) has the molecular formula C9H9N3O4S2 and a molecular weight of 287.32 g/mol. Its IUPAC name is 3-[(1-methylpyrazol-4-yl)sulfonylamino]thiophene-2-carboxylic acid.
| Compound Name | 3-[(1-methylpyrazol-4-yl)sulfonylamino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43443076 |
| Molecular Formula | C9H9N3O4S2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 3-[(1-methylpyrazol-4-yl)sulfonylamino]thiophene-2-carboxylic acid |
| SMILES | Cn1cc(S(=O)(=O)Nc2ccsc2C(=O)O)cn1 |
| InChI | InChI=1S/C9H9N3O4S2/c1-12-5-6(4-10-12)18(15,16)11-7-2-3-17-8(7)9(13)14/h2-5,11H,1H3,(H,13,14) |
| InChIKey | NEAOQXCGDFGNGI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |