C11H10FN3O4S — CID 47257775
4-fluoro-3-[(1-methylpyrazol-4-yl)sulfonylamino]benzoic acid (PubChem CID 47257775) has the molecular formula C11H10FN3O4S and a molecular weight of 299.28 g/mol. Its IUPAC name is 4-fluoro-3-[(1-methylpyrazol-4-yl)sulfonylamino]benzoic acid.
| Compound Name | 4-fluoro-3-[(1-methylpyrazol-4-yl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 47257775 |
| Molecular Formula | C11H10FN3O4S |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 4-fluoro-3-[(1-methylpyrazol-4-yl)sulfonylamino]benzoic acid |
| SMILES | Cn1cc(S(=O)(=O)Nc2cc(C(=O)O)ccc2F)cn1 |
| InChI | InChI=1S/C11H10FN3O4S/c1-15-6-8(5-13-15)20(18,19)14-10-4-7(11(16)17)2-3-9(10)12/h2-6,14H,1H3,(H,16,17) |
| InChIKey | XBURSXDUZWRTOW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |