C8H8FNO4S — CID 47002814
4-fluoro-3-(methanesulfonamido)benzoic acid (PubChem CID 47002814) has the molecular formula C8H8FNO4S and a molecular weight of 233.22 g/mol. Its IUPAC name is 4-fluoro-3-(methanesulfonamido)benzoic acid.
| Compound Name | 4-fluoro-3-(methanesulfonamido)benzoic acid |
|---|---|
| PubChem CID | 47002814 |
| Molecular Formula | C8H8FNO4S |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.02 |
| IUPAC Name | 4-fluoro-3-(methanesulfonamido)benzoic acid |
| SMILES | CS(=O)(=O)Nc1cc(C(=O)O)ccc1F |
| InChI | InChI=1S/C8H8FNO4S/c1-15(13,14)10-7-4-5(8(11)12)2-3-6(7)9/h2-4,10H,1H3,(H,11,12) |
| InChIKey | CPRDLCOJNODCAS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |