C14H19FN2O5S — CID 119188500
2-[[4-fluoro-3-(methanesulfonamido)benzoyl]amino]-4-methylpentanoic acid (PubChem CID 119188500) has the molecular formula C14H19FN2O5S and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-[[4-fluoro-3-(methanesulfonamido)benzoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[4-fluoro-3-(methanesulfonamido)benzoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119188500 |
| Molecular Formula | C14H19FN2O5S |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-[[4-fluoro-3-(methanesulfonamido)benzoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)c1ccc(F)c(NS(C)(=O)=O)c1)C(=O)O |
| InChI | InChI=1S/C14H19FN2O5S/c1-8(2)6-12(14(19)20)16-13(18)9-4-5-10(15)11(7-9)17-23(3,21)22/h4-5,7-8,12,17H,6H2,1-3H3,(H,16,18)(H,19,20) |
| InChIKey | QSUANKDPVVYYDE-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |