C14H17F2NO3 — CID 82815432
(2S)-2-[(2,6-difluoro-3-methylbenzoyl)amino]-4-methylpentanoic acid (PubChem CID 82815432) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is (2S)-2-[(2,6-difluoro-3-methylbenzoyl)amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[(2,6-difluoro-3-methylbenzoyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 82815432 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (2S)-2-[(2,6-difluoro-3-methylbenzoyl)amino]-4-methylpentanoic acid |
| SMILES | Cc1ccc(F)c(C(=O)N[C@@H](CC(C)C)C(=O)O)c1F |
| InChI | InChI=1S/C14H17F2NO3/c1-7(2)6-10(14(19)20)17-13(18)11-9(15)5-4-8(3)12(11)16/h4-5,7,10H,6H2,1-3H3,(H,17,18)(H,19,20)/t10-/m0/s1 |
| InChIKey | CTQCJARNQWFRQY-JTQLQIEISA-N |
| XLogP | 2.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |