C13H13F4NO3 — CID 119364239
(2R)-4-methyl-2-[(2,3,5,6-tetrafluorobenzoyl)amino]pentanoic acid (PubChem CID 119364239) has the molecular formula C13H13F4NO3 and a molecular weight of 307.24 g/mol. Its IUPAC name is (2R)-4-methyl-2-[(2,3,5,6-tetrafluorobenzoyl)amino]pentanoic acid.
| Compound Name | (2R)-4-methyl-2-[(2,3,5,6-tetrafluorobenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 119364239 |
| Molecular Formula | C13H13F4NO3 |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | (2R)-4-methyl-2-[(2,3,5,6-tetrafluorobenzoyl)amino]pentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)c1c(F)c(F)cc(F)c1F)C(=O)O |
| InChI | InChI=1S/C13H13F4NO3/c1-5(2)3-8(13(20)21)18-12(19)9-10(16)6(14)4-7(15)11(9)17/h4-5,8H,3H2,1-2H3,(H,18,19)(H,20,21)/t8-/m1/s1 |
| InChIKey | FGEDDMRSZFGDNC-MRVPVSSYSA-N |
| XLogP | 2.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|