C13H14F2INO3 — CID 119364479
(2R)-2-[(4,5-difluoro-2-iodobenzoyl)amino]-4-methylpentanoic acid (PubChem CID 119364479) has the molecular formula C13H14F2INO3 and a molecular weight of 397.16 g/mol. Its IUPAC name is (2R)-2-[(4,5-difluoro-2-iodobenzoyl)amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[(4,5-difluoro-2-iodobenzoyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119364479 |
| Molecular Formula | C13H14F2INO3 |
| Molecular Weight | 397.16 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | (2R)-2-[(4,5-difluoro-2-iodobenzoyl)amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)c1cc(F)c(F)cc1I)C(=O)O |
| InChI | InChI=1S/C13H14F2INO3/c1-6(2)3-11(13(19)20)17-12(18)7-4-8(14)9(15)5-10(7)16/h4-6,11H,3H2,1-2H3,(H,17,18)(H,19,20)/t11-/m1/s1 |
| InChIKey | VEUCJSDPLZNSAM-LLVKDONJSA-N |
| XLogP | 2.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.16 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|