C13H17F2IN2O — CID 119586236
N-(1-amino-4-methylpentan-2-yl)-4,5-difluoro-2-iodobenzamide (PubChem CID 119586236) has the molecular formula C13H17F2IN2O and a molecular weight of 382.19 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-4,5-difluoro-2-iodobenzamide.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-4,5-difluoro-2-iodobenzamide |
|---|---|
| PubChem CID | 119586236 |
| Molecular Formula | C13H17F2IN2O |
| Molecular Weight | 382.19 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-4,5-difluoro-2-iodobenzamide |
| SMILES | CC(C)CC(CN)NC(=O)c1cc(F)c(F)cc1I |
| InChI | InChI=1S/C13H17F2IN2O/c1-7(2)3-8(6-17)18-13(19)9-4-10(14)11(15)5-12(9)16/h4-5,7-8H,3,6,17H2,1-2H3,(H,18,19) |
| InChIKey | JEGZCTZYSLQMEB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.19 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|