C13H18ClIN2O — CID 119586604
N-(1-amino-4-methylpentan-2-yl)-2-chloro-4-iodobenzamide (PubChem CID 119586604) has the molecular formula C13H18ClIN2O and a molecular weight of 380.66 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-2-chloro-4-iodobenzamide.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-2-chloro-4-iodobenzamide |
|---|---|
| PubChem CID | 119586604 |
| Molecular Formula | C13H18ClIN2O |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-2-chloro-4-iodobenzamide |
| SMILES | CC(C)CC(CN)NC(=O)c1ccc(I)cc1Cl |
| InChI | InChI=1S/C13H18ClIN2O/c1-8(2)5-10(7-16)17-13(18)11-4-3-9(15)6-12(11)14/h3-4,6,8,10H,5,7,16H2,1-2H3,(H,17,18) |
| InChIKey | MYHDFKJKPSSUAA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|