C12H13ClINO3 — CID 119368409
(2R)-2-[(2-chloro-4-iodobenzoyl)amino]-3-methylbutanoic acid (PubChem CID 119368409) has the molecular formula C12H13ClINO3 and a molecular weight of 381.60 g/mol. Its IUPAC name is (2R)-2-[(2-chloro-4-iodobenzoyl)amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(2-chloro-4-iodobenzoyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 119368409 |
| Molecular Formula | C12H13ClINO3 |
| Molecular Weight | 381.60 g/mol |
| Exact Mass | 380.96 |
| IUPAC Name | (2R)-2-[(2-chloro-4-iodobenzoyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)c1ccc(I)cc1Cl)C(=O)O |
| InChI | InChI=1S/C12H13ClINO3/c1-6(2)10(12(17)18)15-11(16)8-4-3-7(14)5-9(8)13/h3-6,10H,1-2H3,(H,15,16)(H,17,18)/t10-/m1/s1 |
| InChIKey | BXCJEQCFVOZFES-SNVBAGLBSA-N |
| XLogP | 2.78 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.60 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|