C12H12I3NO3 — CID 63404941
(2S)-3-methyl-2-[(2,3,5-triiodobenzoyl)amino]butanoic acid (PubChem CID 63404941) has the molecular formula C12H12I3NO3 and a molecular weight of 598.94 g/mol. Its IUPAC name is (2S)-3-methyl-2-[(2,3,5-triiodobenzoyl)amino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[(2,3,5-triiodobenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 63404941 |
| Molecular Formula | C12H12I3NO3 |
| Molecular Weight | 598.94 g/mol |
| Exact Mass | 598.80 |
| IUPAC Name | (2S)-3-methyl-2-[(2,3,5-triiodobenzoyl)amino]butanoic acid |
| SMILES | CC(C)[C@H](NC(=O)c1cc(I)cc(I)c1I)C(=O)O |
| InChI | InChI=1S/C12H12I3NO3/c1-5(2)10(12(18)19)16-11(17)7-3-6(13)4-8(14)9(7)15/h3-5,10H,1-2H3,(H,16,17)(H,18,19)/t10-/m0/s1 |
| InChIKey | YQOAWYHNRVXZLZ-JTQLQIEISA-N |
| XLogP | 3.34 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.94 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|