C12H14I3NO3 — CID 106153883
N-(4-hydroxy-1-methoxybutan-2-yl)-2,3,5-triiodobenzamide (PubChem CID 106153883) has the molecular formula C12H14I3NO3 and a molecular weight of 600.96 g/mol. Its IUPAC name is N-(4-hydroxy-1-methoxybutan-2-yl)-2,3,5-triiodobenzamide.
| Compound Name | N-(4-hydroxy-1-methoxybutan-2-yl)-2,3,5-triiodobenzamide |
|---|---|
| PubChem CID | 106153883 |
| Molecular Formula | C12H14I3NO3 |
| Molecular Weight | 600.96 g/mol |
| Exact Mass | 600.81 |
| IUPAC Name | N-(4-hydroxy-1-methoxybutan-2-yl)-2,3,5-triiodobenzamide |
| SMILES | COCC(CCO)NC(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C12H14I3NO3/c1-19-6-8(2-3-17)16-12(18)9-4-7(13)5-10(14)11(9)15/h4-5,8,17H,2-3,6H2,1H3,(H,16,18) |
| InChIKey | QJRFTZJECIBKHW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.96 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|