C10H14BrNO4 — CID 106899013
2-bromo-N-(4-hydroxy-1-methoxybutan-2-yl)furan-3-carboxamide (PubChem CID 106899013) has the molecular formula C10H14BrNO4 and a molecular weight of 292.13 g/mol. Its IUPAC name is 2-bromo-N-(4-hydroxy-1-methoxybutan-2-yl)furan-3-carboxamide.
| Compound Name | 2-bromo-N-(4-hydroxy-1-methoxybutan-2-yl)furan-3-carboxamide |
|---|---|
| PubChem CID | 106899013 |
| Molecular Formula | C10H14BrNO4 |
| Molecular Weight | 292.13 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 2-bromo-N-(4-hydroxy-1-methoxybutan-2-yl)furan-3-carboxamide |
| SMILES | COCC(CCO)NC(=O)c1ccoc1Br |
| InChI | InChI=1S/C10H14BrNO4/c1-15-6-7(2-4-13)12-10(14)8-3-5-16-9(8)11/h3,5,7,13H,2,4,6H2,1H3,(H,12,14) |
| InChIKey | DPYDRBSNWCVUON-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.13 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |