C11H18N2O3 — CID 106152130
N-(4-amino-1-methoxybutan-2-yl)-2-methylfuran-3-carboxamide (PubChem CID 106152130) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is N-(4-amino-1-methoxybutan-2-yl)-2-methylfuran-3-carboxamide.
| Compound Name | N-(4-amino-1-methoxybutan-2-yl)-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 106152130 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | N-(4-amino-1-methoxybutan-2-yl)-2-methylfuran-3-carboxamide |
| SMILES | COCC(CCN)NC(=O)c1ccoc1C |
| InChI | InChI=1S/C11H18N2O3/c1-8-10(4-6-16-8)11(14)13-9(3-5-12)7-15-2/h4,6,9H,3,5,7,12H2,1-2H3,(H,13,14) |
| InChIKey | GLJADECBPGKHQJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |