C11H18N2O4 — CID 106160982
5-(aminomethyl)-N-(4-hydroxy-1-methoxybutan-2-yl)furan-2-carboxamide (PubChem CID 106160982) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(4-hydroxy-1-methoxybutan-2-yl)furan-2-carboxamide.
| Compound Name | 5-(aminomethyl)-N-(4-hydroxy-1-methoxybutan-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 106160982 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 5-(aminomethyl)-N-(4-hydroxy-1-methoxybutan-2-yl)furan-2-carboxamide |
| SMILES | COCC(CCO)NC(=O)c1ccc(CN)o1 |
| InChI | InChI=1S/C11H18N2O4/c1-16-7-8(4-5-14)13-11(15)10-3-2-9(6-12)17-10/h2-3,8,14H,4-7,12H2,1H3,(H,13,15) |
| InChIKey | SHQDACGLKPIHAQ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |