C13H23ClN2O3 — CID 119585925
N-(1-amino-4-methylpentan-2-yl)-5-(methoxymethyl)furan-2-carboxamide;hydrochloride (PubChem CID 119585925) has the molecular formula C13H23ClN2O3 and a molecular weight of 290.79 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-5-(methoxymethyl)furan-2-carboxamide;hydrochloride.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-5-(methoxymethyl)furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119585925 |
| Molecular Formula | C13H23ClN2O3 |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-5-(methoxymethyl)furan-2-carboxamide;hydrochloride |
| SMILES | COCc1ccc(C(=O)NC(CN)CC(C)C)o1.Cl |
| InChI | InChI=1S/C13H22N2O3.ClH/c1-9(2)6-10(7-14)15-13(16)12-5-4-11(18-12)8-17-3;/h4-5,9-10H,6-8,14H2,1-3H3,(H,15,16);1H |
| InChIKey | TZJFCCDIRGDCAL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |