C10H17ClN2O3 — CID 119500596
5-(methoxymethyl)-N-[2-(methylamino)ethyl]furan-2-carboxamide;hydrochloride (PubChem CID 119500596) has the molecular formula C10H17ClN2O3 and a molecular weight of 248.71 g/mol. Its IUPAC name is 5-(methoxymethyl)-N-[2-(methylamino)ethyl]furan-2-carboxamide;hydrochloride.
| Compound Name | 5-(methoxymethyl)-N-[2-(methylamino)ethyl]furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119500596 |
| Molecular Formula | C10H17ClN2O3 |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 5-(methoxymethyl)-N-[2-(methylamino)ethyl]furan-2-carboxamide;hydrochloride |
| SMILES | CNCCNC(=O)c1ccc(COC)o1.Cl |
| InChI | InChI=1S/C10H16N2O3.ClH/c1-11-5-6-12-10(13)9-4-3-8(15-9)7-14-2;/h3-4,11H,5-7H2,1-2H3,(H,12,13);1H |
| InChIKey | HMXUZXJUGQKQET-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|