C12H18N2O4 — CID 78827647
5-(methoxymethyl)-N-[2-oxo-2-(propylamino)ethyl]furan-2-carboxamide (PubChem CID 78827647) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 5-(methoxymethyl)-N-[2-oxo-2-(propylamino)ethyl]furan-2-carboxamide.
| Compound Name | 5-(methoxymethyl)-N-[2-oxo-2-(propylamino)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 78827647 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 5-(methoxymethyl)-N-[2-oxo-2-(propylamino)ethyl]furan-2-carboxamide |
| SMILES | CCCNC(=O)CNC(=O)c1ccc(COC)o1 |
| InChI | InChI=1S/C12H18N2O4/c1-3-6-13-11(15)7-14-12(16)10-5-4-9(18-10)8-17-2/h4-5H,3,6-8H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | PGEUXMFMCFPANZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |