C12H20N2O3 — CID 120650443
N-[(2R)-2-(ethylamino)propyl]-5-(methoxymethyl)furan-2-carboxamide (PubChem CID 120650443) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-5-(methoxymethyl)furan-2-carboxamide.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-5-(methoxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 120650443 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-5-(methoxymethyl)furan-2-carboxamide |
| SMILES | CCN[C@H](C)CNC(=O)c1ccc(COC)o1 |
| InChI | InChI=1S/C12H20N2O3/c1-4-13-9(2)7-14-12(15)11-6-5-10(17-11)8-16-3/h5-6,9,13H,4,7-8H2,1-3H3,(H,14,15)/t9-/m1/s1 |
| InChIKey | KTXKQQYQFSWXGC-SECBINFHSA-N |
| XLogP | 1.15 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |