C8H12BrClN2O2 — CID 119500440
5-bromo-N-[2-(methylamino)ethyl]furan-2-carboxamide;hydrochloride (PubChem CID 119500440) has the molecular formula C8H12BrClN2O2 and a molecular weight of 283.55 g/mol. Its IUPAC name is 5-bromo-N-[2-(methylamino)ethyl]furan-2-carboxamide;hydrochloride.
| Compound Name | 5-bromo-N-[2-(methylamino)ethyl]furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119500440 |
| Molecular Formula | C8H12BrClN2O2 |
| Molecular Weight | 283.55 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 5-bromo-N-[2-(methylamino)ethyl]furan-2-carboxamide;hydrochloride |
| SMILES | CNCCNC(=O)c1ccc(Br)o1.Cl |
| InChI | InChI=1S/C8H11BrN2O2.ClH/c1-10-4-5-11-8(12)6-2-3-7(9)13-6;/h2-3,10H,4-5H2,1H3,(H,11,12);1H |
| InChIKey | XAWKABCONDKSNV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.55 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|