C8H9BrN2O2S — CID 62665925
N-(3-amino-3-sulfanylidenepropyl)-5-bromofuran-2-carboxamide (PubChem CID 62665925) has the molecular formula C8H9BrN2O2S and a molecular weight of 277.14 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-5-bromofuran-2-carboxamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-5-bromofuran-2-carboxamide |
|---|---|
| PubChem CID | 62665925 |
| Molecular Formula | C8H9BrN2O2S |
| Molecular Weight | 277.14 g/mol |
| Exact Mass | 275.96 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-5-bromofuran-2-carboxamide |
| SMILES | NC(=S)CCNC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C8H9BrN2O2S/c9-6-2-1-5(13-6)8(12)11-4-3-7(10)14/h1-2H,3-4H2,(H2,10,14)(H,11,12) |
| InChIKey | SZZVPHVEJSGMLT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.14 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|