C7H8BrN3O3 — CID 10378007
5-bromo-N-(2-hydrazinyl-2-oxoethyl)furan-2-carboxamide (PubChem CID 10378007) has the molecular formula C7H8BrN3O3 and a molecular weight of 262.06 g/mol. Its IUPAC name is 5-bromo-N-(2-hydrazinyl-2-oxoethyl)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(2-hydrazinyl-2-oxoethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 10378007 |
| Molecular Formula | C7H8BrN3O3 |
| Molecular Weight | 262.06 g/mol |
| Exact Mass | 260.97 |
| IUPAC Name | 5-bromo-N-(2-hydrazinyl-2-oxoethyl)furan-2-carboxamide |
| SMILES | NNC(=O)CNC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C7H8BrN3O3/c8-5-2-1-4(14-5)7(13)10-3-6(12)11-9/h1-2H,3,9H2,(H,10,13)(H,11,12) |
| InChIKey | JLQJMCLXLLMSFT-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.06 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|