C11H13BrN2O6 — CID 43406149
methyl 2-[[2-[(5-bromofuran-2-carbonyl)amino]acetyl]amino]-3-hydroxypropanoate (PubChem CID 43406149) has the molecular formula C11H13BrN2O6 and a molecular weight of 349.14 g/mol. Its IUPAC name is methyl 2-[[2-[(5-bromofuran-2-carbonyl)amino]acetyl]amino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[[2-[(5-bromofuran-2-carbonyl)amino]acetyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 43406149 |
| Molecular Formula | C11H13BrN2O6 |
| Molecular Weight | 349.14 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | methyl 2-[[2-[(5-bromofuran-2-carbonyl)amino]acetyl]amino]-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)NC(=O)CNC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C11H13BrN2O6/c1-19-11(18)6(5-15)14-9(16)4-13-10(17)7-2-3-8(12)20-7/h2-3,6,15H,4-5H2,1H3,(H,13,17)(H,14,16) |
| InChIKey | ZZEIKIGCKDGUNY-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.14 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |