C9H8BrF3N2O4 — CID 81434793
5-bromo-N-[2-oxo-2-(2,2,2-trifluoroethoxyamino)ethyl]furan-2-carboxamide (PubChem CID 81434793) has the molecular formula C9H8BrF3N2O4 and a molecular weight of 345.07 g/mol. Its IUPAC name is 5-bromo-N-[2-oxo-2-(2,2,2-trifluoroethoxyamino)ethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-oxo-2-(2,2,2-trifluoroethoxyamino)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 81434793 |
| Molecular Formula | C9H8BrF3N2O4 |
| Molecular Weight | 345.07 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | 5-bromo-N-[2-oxo-2-(2,2,2-trifluoroethoxyamino)ethyl]furan-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc(Br)o1)NOCC(F)(F)F |
| InChI | InChI=1S/C9H8BrF3N2O4/c10-6-2-1-5(19-6)8(17)14-3-7(16)15-18-4-9(11,12)13/h1-2H,3-4H2,(H,14,17)(H,15,16) |
| InChIKey | MWYJDAFMNWDJGL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.07 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|