C13H10BrF2NO2 — CID 110795401
5-bromo-N-[2-(3,4-difluorophenyl)ethyl]furan-2-carboxamide (PubChem CID 110795401) has the molecular formula C13H10BrF2NO2 and a molecular weight of 330.13 g/mol. Its IUPAC name is 5-bromo-N-[2-(3,4-difluorophenyl)ethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-(3,4-difluorophenyl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 110795401 |
| Molecular Formula | C13H10BrF2NO2 |
| Molecular Weight | 330.13 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 5-bromo-N-[2-(3,4-difluorophenyl)ethyl]furan-2-carboxamide |
| SMILES | O=C(NCCc1ccc(F)c(F)c1)c1ccc(Br)o1 |
| InChI | InChI=1S/C13H10BrF2NO2/c14-12-4-3-11(19-12)13(18)17-6-5-8-1-2-9(15)10(16)7-8/h1-4,7H,5-6H2,(H,17,18) |
| InChIKey | PTWOEJRBBXEJAB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.13 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |