C12H8ClF2NO2 — CID 103612091
5-chloro-N-[(3,4-difluorophenyl)methyl]furan-2-carboxamide (PubChem CID 103612091) has the molecular formula C12H8ClF2NO2 and a molecular weight of 271.65 g/mol. Its IUPAC name is 5-chloro-N-[(3,4-difluorophenyl)methyl]furan-2-carboxamide.
| Compound Name | 5-chloro-N-[(3,4-difluorophenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 103612091 |
| Molecular Formula | C12H8ClF2NO2 |
| Molecular Weight | 271.65 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 5-chloro-N-[(3,4-difluorophenyl)methyl]furan-2-carboxamide |
| SMILES | O=C(NCc1ccc(F)c(F)c1)c1ccc(Cl)o1 |
| InChI | InChI=1S/C12H8ClF2NO2/c13-11-4-3-10(18-11)12(17)16-6-7-1-2-8(14)9(15)5-7/h1-5H,6H2,(H,16,17) |
| InChIKey | HKLPWFCIJQCNSB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.65 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |