C15H10BrClF3NO — CID 171463750
5-bromo-4-chloro-N-[(3,4-difluorophenyl)methyl]-2-fluoro-3-methylbenzamide (PubChem CID 171463750) has the molecular formula C15H10BrClF3NO and a molecular weight of 392.60 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-[(3,4-difluorophenyl)methyl]-2-fluoro-3-methylbenzamide.
| Compound Name | 5-bromo-4-chloro-N-[(3,4-difluorophenyl)methyl]-2-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 171463750 |
| Molecular Formula | C15H10BrClF3NO |
| Molecular Weight | 392.60 g/mol |
| Exact Mass | 390.96 |
| IUPAC Name | 5-bromo-4-chloro-N-[(3,4-difluorophenyl)methyl]-2-fluoro-3-methylbenzamide |
| SMILES | Cc1c(F)c(C(=O)NCc2ccc(F)c(F)c2)cc(Br)c1Cl |
| InChI | InChI=1S/C15H10BrClF3NO/c1-7-13(17)10(16)5-9(14(7)20)15(22)21-6-8-2-3-11(18)12(19)4-8/h2-5H,6H2,1H3,(H,21,22) |
| InChIKey | GHCAFPGSZMPENL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|