C13H10ClF2NO2 — CID 113228849
5-chloro-N-[2-(3,5-difluorophenyl)ethyl]furan-2-carboxamide (PubChem CID 113228849) has the molecular formula C13H10ClF2NO2 and a molecular weight of 285.68 g/mol. Its IUPAC name is 5-chloro-N-[2-(3,5-difluorophenyl)ethyl]furan-2-carboxamide.
| Compound Name | 5-chloro-N-[2-(3,5-difluorophenyl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 113228849 |
| Molecular Formula | C13H10ClF2NO2 |
| Molecular Weight | 285.68 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 5-chloro-N-[2-(3,5-difluorophenyl)ethyl]furan-2-carboxamide |
| SMILES | O=C(NCCc1cc(F)cc(F)c1)c1ccc(Cl)o1 |
| InChI | InChI=1S/C13H10ClF2NO2/c14-12-2-1-11(19-12)13(18)17-4-3-8-5-9(15)7-10(16)6-8/h1-2,5-7H,3-4H2,(H,17,18) |
| InChIKey | OPBKICQBUBHITK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.68 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |