C13H13ClN2O4S — CID 32766645
5-chloro-N-[[4-(sulfamoylmethyl)phenyl]methyl]furan-2-carboxamide (PubChem CID 32766645) has the molecular formula C13H13ClN2O4S and a molecular weight of 328.78 g/mol. Its IUPAC name is 5-chloro-N-[[4-(sulfamoylmethyl)phenyl]methyl]furan-2-carboxamide.
| Compound Name | 5-chloro-N-[[4-(sulfamoylmethyl)phenyl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 32766645 |
| Molecular Formula | C13H13ClN2O4S |
| Molecular Weight | 328.78 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 5-chloro-N-[[4-(sulfamoylmethyl)phenyl]methyl]furan-2-carboxamide |
| SMILES | NS(=O)(=O)Cc1ccc(CNC(=O)c2ccc(Cl)o2)cc1 |
| InChI | InChI=1S/C13H13ClN2O4S/c14-12-6-5-11(20-12)13(17)16-7-9-1-3-10(4-2-9)8-21(15,18)19/h1-6H,7-8H2,(H,16,17)(H2,15,18,19) |
| InChIKey | BCBMFNJVKZGGLL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.78 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |