C9H12ClNO3 — CID 65109429
5-chloro-N-(2-hydroxy-2-methylpropyl)furan-2-carboxamide (PubChem CID 65109429) has the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. Its IUPAC name is 5-chloro-N-(2-hydroxy-2-methylpropyl)furan-2-carboxamide.
| Compound Name | 5-chloro-N-(2-hydroxy-2-methylpropyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 65109429 |
| Molecular Formula | C9H12ClNO3 |
| Molecular Weight | 217.65 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 5-chloro-N-(2-hydroxy-2-methylpropyl)furan-2-carboxamide |
| SMILES | CC(C)(O)CNC(=O)c1ccc(Cl)o1 |
| InChI | InChI=1S/C9H12ClNO3/c1-9(2,13)5-11-8(12)6-3-4-7(10)14-6/h3-4,13H,5H2,1-2H3,(H,11,12) |
| InChIKey | WXUOCVZRVOBMHE-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.65 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |