C11H16ClNO3 — CID 111483845
5-chloro-N-(2-hydroxy-2,3-dimethylbutyl)furan-2-carboxamide (PubChem CID 111483845) has the molecular formula C11H16ClNO3 and a molecular weight of 245.71 g/mol. Its IUPAC name is 5-chloro-N-(2-hydroxy-2,3-dimethylbutyl)furan-2-carboxamide.
| Compound Name | 5-chloro-N-(2-hydroxy-2,3-dimethylbutyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 111483845 |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 5-chloro-N-(2-hydroxy-2,3-dimethylbutyl)furan-2-carboxamide |
| SMILES | CC(C)C(C)(O)CNC(=O)c1ccc(Cl)o1 |
| InChI | InChI=1S/C11H16ClNO3/c1-7(2)11(3,15)6-13-10(14)8-4-5-9(12)16-8/h4-5,7,15H,6H2,1-3H3,(H,13,14) |
| InChIKey | XEYINHMTEATCFU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |