C12H18ClNO3 — CID 111480015
5-chloro-N-(4-hydroxy-2,2-dimethylpentyl)furan-2-carboxamide (PubChem CID 111480015) has the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. Its IUPAC name is 5-chloro-N-(4-hydroxy-2,2-dimethylpentyl)furan-2-carboxamide.
| Compound Name | 5-chloro-N-(4-hydroxy-2,2-dimethylpentyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 111480015 |
| Molecular Formula | C12H18ClNO3 |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 5-chloro-N-(4-hydroxy-2,2-dimethylpentyl)furan-2-carboxamide |
| SMILES | CC(O)CC(C)(C)CNC(=O)c1ccc(Cl)o1 |
| InChI | InChI=1S/C12H18ClNO3/c1-8(15)6-12(2,3)7-14-11(16)9-4-5-10(13)17-9/h4-5,8,15H,6-7H2,1-3H3,(H,14,16) |
| InChIKey | IVHKUBMMQAZMAE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |