C15H22N2O3 — CID 111520130
4-N-(4-hydroxy-2,2-dimethylpentyl)benzene-1,4-dicarboxamide (PubChem CID 111520130) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 4-N-(4-hydroxy-2,2-dimethylpentyl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(4-hydroxy-2,2-dimethylpentyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 111520130 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 4-N-(4-hydroxy-2,2-dimethylpentyl)benzene-1,4-dicarboxamide |
| SMILES | CC(O)CC(C)(C)CNC(=O)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C15H22N2O3/c1-10(18)8-15(2,3)9-17-14(20)12-6-4-11(5-7-12)13(16)19/h4-7,10,18H,8-9H2,1-3H3,(H2,16,19)(H,17,20) |
| InChIKey | WQEXOCWRDADGSF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |