C11H14N2O3 — CID 83059637
4-N-[(2S)-2-hydroxypropyl]benzene-1,4-dicarboxamide (PubChem CID 83059637) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 4-N-[(2S)-2-hydroxypropyl]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-[(2S)-2-hydroxypropyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 83059637 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 4-N-[(2S)-2-hydroxypropyl]benzene-1,4-dicarboxamide |
| SMILES | C[C@H](O)CNC(=O)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C11H14N2O3/c1-7(14)6-13-11(16)9-4-2-8(3-5-9)10(12)15/h2-5,7,14H,6H2,1H3,(H2,12,15)(H,13,16)/t7-/m0/s1 |
| InChIKey | KKLVUHYUBJUKFX-ZETCQYMHSA-N |
| XLogP | -0.10 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |