C10H14N4O2 — CID 172799117
4-N-(2,2-diaminoethyl)benzene-1,4-dicarboxamide (PubChem CID 172799117) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 4-N-(2,2-diaminoethyl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(2,2-diaminoethyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 172799117 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 4-N-(2,2-diaminoethyl)benzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(=O)NCC(N)N)cc1 |
| InChI | InChI=1S/C10H14N4O2/c11-8(12)5-14-10(16)7-3-1-6(2-4-7)9(13)15/h1-4,8H,5,11-12H2,(H2,13,15)(H,14,16) |
| InChIKey | QPPSLRZHMMYYQI-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|