C13H18N2O3 — CID 115703395
4-N-(3-hydroxypentyl)benzene-1,4-dicarboxamide (PubChem CID 115703395) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 4-N-(3-hydroxypentyl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(3-hydroxypentyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 115703395 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 4-N-(3-hydroxypentyl)benzene-1,4-dicarboxamide |
| SMILES | CCC(O)CCNC(=O)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C13H18N2O3/c1-2-11(16)7-8-15-13(18)10-5-3-9(4-6-10)12(14)17/h3-6,11,16H,2,7-8H2,1H3,(H2,14,17)(H,15,18) |
| InChIKey | YGSOXWXUIFNOQE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |