C12H14N2O5 — CID 107832721
4-[(4-carbamoylbenzoyl)amino]-2-hydroxybutanoic acid (PubChem CID 107832721) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is 4-[(4-carbamoylbenzoyl)amino]-2-hydroxybutanoic acid.
| Compound Name | 4-[(4-carbamoylbenzoyl)amino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107832721 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 4-[(4-carbamoylbenzoyl)amino]-2-hydroxybutanoic acid |
| SMILES | NC(=O)c1ccc(C(=O)NCCC(O)C(=O)O)cc1 |
| InChI | InChI=1S/C12H14N2O5/c13-10(16)7-1-3-8(4-2-7)11(17)14-6-5-9(15)12(18)19/h1-4,9,15H,5-6H2,(H2,13,16)(H,14,17)(H,18,19) |
| InChIKey | SDTFYZBAIWHWHW-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |