(2S)-4-[(3,5-dichlorobenzoyl)amino]-2-hydroxybutanoic acid

C11H11Cl2NO4 — CID 107834723

IUPAC(2S)-4-[(3,5-dichlorobenzoyl)amino]-2-hydroxybutanoic acid
SMILESO=C(NCC[C@H](O)C(=O)O)c1cc(Cl)cc(Cl)c1
InChIInChI=1S/C11H11Cl2NO4/c12-7-3-6(4-8(13)5-7)10(16)14-2-1-9(15)11(17)18/h3-5,9,15H,1-2H2,(H,14,16)(H,17,18)/t9-/m0/s1
InChIKeyCCTRMFQNFBJZEZ-VIFPVBQESA-N
MW292.12 g/mol
LogP1.56
Rot. Bonds5

About (2S)-4-[(3,5-dichlorobenzoyl)amino]-2-hydroxybutanoic acid

(2S)-4-[(3,5-dichlorobenzoyl)amino]-2-hydroxybutanoic acid (PubChem CID 107834723) has the molecular formula C11H11Cl2NO4 and a molecular weight of 292.12 g/mol. Its IUPAC name is (2S)-4-[(3,5-dichlorobenzoyl)amino]-2-hydroxybutanoic acid.

Molecular Properties

Compound Name(2S)-4-[(3,5-dichlorobenzoyl)amino]-2-hydroxybutanoic acid
PubChem CID107834723
Molecular FormulaC11H11Cl2NO4
Molecular Weight292.12 g/mol
Exact Mass291.01
IUPAC Name(2S)-4-[(3,5-dichlorobenzoyl)amino]-2-hydroxybutanoic acid
SMILESO=C(NCC[C@H](O)C(=O)O)c1cc(Cl)cc(Cl)c1
InChIInChI=1S/C11H11Cl2NO4/c12-7-3-6(4-8(13)5-7)10(16)14-2-1-9(15)11(17)18/h3-5,9,15H,1-2H2,(H,14,16)(H,17,18)/t9-/m0/s1
InChIKeyCCTRMFQNFBJZEZ-VIFPVBQESA-N
XLogP1.56
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.12
LogP ≤ 51.56
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (2S)-4-[(3,5-dichlorobenzoyl)amino]-2-hydroxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-4-[(3,5-dichlorobenzoyl)amino]-2-hydroxybutanoic acid?
The IUPAC name of (2S)-4-[(3,5-dichlorobenzoyl)amino]-2-hydroxybutanoic acid (CID 107834723) is (2S)-4-[(3,5-dichlorobenzoyl)amino]-2-hydroxybutanoic acid.
What is the SMILES notation for (2S)-4-[(3,5-dichlorobenzoyl)amino]-2-hydroxybutanoic acid?
The canonical SMILES for (2S)-4-[(3,5-dichlorobenzoyl)amino]-2-hydroxybutanoic acid is O=C(NCC[C@H](O)C(=O)O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of (2S)-4-[(3,5-dichlorobenzoyl)amino]-2-hydroxybutanoic acid?
The InChIKey is CCTRMFQNFBJZEZ-VIFPVBQESA-N. The full InChI is InChI=1S/C11H11Cl2NO4/c12-7-3-6(4-8(13)5-7)10(16)14-2-1-9(15)11(17)18/h3-5,9,15H,1-2H2,(H,14,16)(H,17,18)/t9-/m0/s1.
What are the key properties of (2S)-4-[(3,5-dichlorobenzoyl)amino]-2-hydroxybutanoic acid?
(2S)-4-[(3,5-dichlorobenzoyl)amino]-2-hydroxybutanoic acid has a molecular weight of 292.12 g/mol, XLogP of 1.56, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-[(3,5-dichlorobenzoyl)amino]-2-hydroxybutanoic acid is sourced from PubChem (CID 107834723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).