C12H13BrN2O2 — CID 126828005
4-N-[(1-bromocyclopropyl)methyl]benzene-1,4-dicarboxamide (PubChem CID 126828005) has the molecular formula C12H13BrN2O2 and a molecular weight of 297.15 g/mol. Its IUPAC name is 4-N-[(1-bromocyclopropyl)methyl]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-[(1-bromocyclopropyl)methyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 126828005 |
| Molecular Formula | C12H13BrN2O2 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 4-N-[(1-bromocyclopropyl)methyl]benzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(=O)NCC2(Br)CC2)cc1 |
| InChI | InChI=1S/C12H13BrN2O2/c13-12(5-6-12)7-15-11(17)9-3-1-8(2-4-9)10(14)16/h1-4H,5-7H2,(H2,14,16)(H,15,17) |
| InChIKey | BUPVIJSJPHOUSM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|