C11H11ClN2O2 — CID 115636455
4-N-(2-chloroprop-2-enyl)benzene-1,4-dicarboxamide (PubChem CID 115636455) has the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. Its IUPAC name is 4-N-(2-chloroprop-2-enyl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(2-chloroprop-2-enyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 115636455 |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 4-N-(2-chloroprop-2-enyl)benzene-1,4-dicarboxamide |
| SMILES | C=C(Cl)CNC(=O)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C11H11ClN2O2/c1-7(12)6-14-11(16)9-4-2-8(3-5-9)10(13)15/h2-5H,1,6H2,(H2,13,15)(H,14,16) |
| InChIKey | CQAGRMAOAOJKMJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |