C14H20N2O3 — CID 103772906
4-N-(4-hydroxy-2,2-dimethylbutyl)benzene-1,4-dicarboxamide (PubChem CID 103772906) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 4-N-(4-hydroxy-2,2-dimethylbutyl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(4-hydroxy-2,2-dimethylbutyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 103772906 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 4-N-(4-hydroxy-2,2-dimethylbutyl)benzene-1,4-dicarboxamide |
| SMILES | CC(C)(CCO)CNC(=O)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C14H20N2O3/c1-14(2,7-8-17)9-16-13(19)11-5-3-10(4-6-11)12(15)18/h3-6,17H,7-9H2,1-2H3,(H2,15,18)(H,16,19) |
| InChIKey | UIQBASVQNHUOEM-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |