C11H17N3O2 — CID 104629634
N-(4-hydroxy-2,2-dimethylbutyl)pyrimidine-5-carboxamide (PubChem CID 104629634) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is N-(4-hydroxy-2,2-dimethylbutyl)pyrimidine-5-carboxamide.
| Compound Name | N-(4-hydroxy-2,2-dimethylbutyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 104629634 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | N-(4-hydroxy-2,2-dimethylbutyl)pyrimidine-5-carboxamide |
| SMILES | CC(C)(CCO)CNC(=O)c1cncnc1 |
| InChI | InChI=1S/C11H17N3O2/c1-11(2,3-4-15)7-14-10(16)9-5-12-8-13-6-9/h5-6,8,15H,3-4,7H2,1-2H3,(H,14,16) |
| InChIKey | KRCNNNYVWXANSV-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |