C13H16FNO2S — CID 111484978
4-fluoro-N-[(4-hydroxythian-4-yl)methyl]benzamide (PubChem CID 111484978) has the molecular formula C13H16FNO2S and a molecular weight of 269.34 g/mol. Its IUPAC name is 4-fluoro-N-[(4-hydroxythian-4-yl)methyl]benzamide.
| Compound Name | 4-fluoro-N-[(4-hydroxythian-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 111484978 |
| Molecular Formula | C13H16FNO2S |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 4-fluoro-N-[(4-hydroxythian-4-yl)methyl]benzamide |
| SMILES | O=C(NCC1(O)CCSCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H16FNO2S/c14-11-3-1-10(2-4-11)12(16)15-9-13(17)5-7-18-8-6-13/h1-4,17H,5-9H2,(H,15,16) |
| InChIKey | DQZFVVPNYJMFHN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |