C13H15BrFNO2S — CID 111484646
3-bromo-4-fluoro-N-[(4-hydroxythian-4-yl)methyl]benzamide (PubChem CID 111484646) has the molecular formula C13H15BrFNO2S and a molecular weight of 348.24 g/mol. Its IUPAC name is 3-bromo-4-fluoro-N-[(4-hydroxythian-4-yl)methyl]benzamide.
| Compound Name | 3-bromo-4-fluoro-N-[(4-hydroxythian-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 111484646 |
| Molecular Formula | C13H15BrFNO2S |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | 3-bromo-4-fluoro-N-[(4-hydroxythian-4-yl)methyl]benzamide |
| SMILES | O=C(NCC1(O)CCSCC1)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C13H15BrFNO2S/c14-10-7-9(1-2-11(10)15)12(17)16-8-13(18)3-5-19-6-4-13/h1-2,7,18H,3-6,8H2,(H,16,17) |
| InChIKey | CZDVMTLPSGRRDZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |